C22H20F3N3O2 — CID 75526416
1-benzyl-1-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-pyridin-2-ylurea (PubChem CID 75526416) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 1-benzyl-1-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-pyridin-2-ylurea.
| Compound Name | 1-benzyl-1-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 75526416 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-benzyl-1-[2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)N(Cc1ccccc1)CC(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H20F3N3O2/c23-22(24,25)18-11-5-4-10-17(18)19(29)15-28(14-16-8-2-1-3-9-16)21(30)27-20-12-6-7-13-26-20/h1-13,19,29H,14-15H2,(H,26,27,30) |
| InChIKey | DXJKRJYXZIRFNG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |