C24H21N3O2 — CID 108812654
1,1-dibenzyl-3-(5-phenyl-1,2-oxazol-3-yl)urea (PubChem CID 108812654) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1,1-dibenzyl-3-(5-phenyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1,1-dibenzyl-3-(5-phenyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 108812654 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1,1-dibenzyl-3-(5-phenyl-1,2-oxazol-3-yl)urea |
| SMILES | O=C(Nc1cc(-c2ccccc2)on1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H21N3O2/c28-24(25-23-16-22(29-26-23)21-14-8-3-9-15-21)27(17-19-10-4-1-5-11-19)18-20-12-6-2-7-13-20/h1-16H,17-18H2,(H,25,26,28) |
| InChIKey | BVFLESRDGXARMK-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |