About ethyl 3-fluoro-4-iodobutanoate
ethyl 3-fluoro-4-iodobutanoate (PubChem CID 75530091) has the molecular formula C6H10FIO2
and a molecular weight of 260.05 g/mol. Its IUPAC name is ethyl 3-fluoro-4-iodobutanoate.
Molecular Properties
| Compound Name | ethyl 3-fluoro-4-iodobutanoate |
| PubChem CID | 75530091 |
| Molecular Formula | C6H10FIO2 |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | ethyl 3-fluoro-4-iodobutanoate |
| SMILES | CCOC(=O)CC(F)CI |
| InChI | InChI=1S/C6H10FIO2/c1-2-10-6(9)3-5(7)4-8/h5H,2-4H2,1H3 |
| InChIKey | WUUBUKVGTSSUEO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-fluoro-4-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-fluoro-4-iodobutanoate?
The IUPAC name of ethyl 3-fluoro-4-iodobutanoate (CID 75530091) is ethyl 3-fluoro-4-iodobutanoate.
What is the SMILES notation for ethyl 3-fluoro-4-iodobutanoate?
The canonical SMILES for ethyl 3-fluoro-4-iodobutanoate is CCOC(=O)CC(F)CI.
What is the InChIKey of ethyl 3-fluoro-4-iodobutanoate?
The InChIKey is WUUBUKVGTSSUEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FIO2/c1-2-10-6(9)3-5(7)4-8/h5H,2-4H2,1H3.
What are the key properties of ethyl 3-fluoro-4-iodobutanoate?
ethyl 3-fluoro-4-iodobutanoate has a molecular weight of 260.05 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-fluoro-4-iodobutanoate is sourced from PubChem (CID 75530091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).