C12H21F3N4 — CID 75533016
N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide (PubChem CID 75533016) has the molecular formula C12H21F3N4 and a molecular weight of 278.32 g/mol. Its IUPAC name is N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide.
| Compound Name | N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 75533016 |
| Molecular Formula | C12H21F3N4 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N'-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\C1CCN(CC(F)(F)F)C1)N1CCCCC1 |
| InChI | InChI=1S/C12H21F3N4/c13-12(14,15)9-18-7-4-10(8-18)17-11(16)19-5-2-1-3-6-19/h10H,1-9H2,(H2,16,17) |
| InChIKey | LHPYXJJYXYNXGT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|