C17H17FN2O3S — CID 75534307
(E)-4-(3-fluorophenyl)-N-[4-(sulfamoylmethyl)phenyl]but-3-enamide (PubChem CID 75534307) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is (E)-4-(3-fluorophenyl)-N-[4-(sulfamoylmethyl)phenyl]but-3-enamide.
| Compound Name | (E)-4-(3-fluorophenyl)-N-[4-(sulfamoylmethyl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 75534307 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (E)-4-(3-fluorophenyl)-N-[4-(sulfamoylmethyl)phenyl]but-3-enamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)C/C=C/c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H17FN2O3S/c18-15-5-1-3-13(11-15)4-2-6-17(21)20-16-9-7-14(8-10-16)12-24(19,22)23/h1-5,7-11H,6,12H2,(H,20,21)(H2,19,22,23)/b4-2+ |
| InChIKey | FHBYYLVALLRFNN-DUXPYHPUSA-N |
| XLogP | 2.66 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |