C19H23N3O4 — CID 75536774
1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-phenylurea (PubChem CID 75536774) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 75536774 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-phenylurea |
| SMILES | O=C(NC[C@H]1OC[C@@H](NCc2ccccc2O)[C@@H]1O)Nc1ccccc1 |
| InChI | InChI=1S/C19H23N3O4/c23-16-9-5-4-6-13(16)10-20-15-12-26-17(18(15)24)11-21-19(25)22-14-7-2-1-3-8-14/h1-9,15,17-18,20,23-24H,10-12H2,(H2,21,22,25)/t15-,17-,18+/m1/s1 |
| InChIKey | HZBSTGWVMJYDAF-NXHRZFHOSA-N |
| XLogP | 1.43 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|