C18H21FN2O4S — CID 162789837
N-[[4-[(2-fluorophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide (PubChem CID 162789837) has the molecular formula C18H21FN2O4S and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[[4-[(2-fluorophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[(2-fluorophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162789837 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[[4-[(2-fluorophenyl)methylamino]-3-hydroxyoxolan-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1OCC(NCc2ccccc2F)C1O)c1ccccc1 |
| InChI | InChI=1S/C18H21FN2O4S/c19-15-9-5-4-6-13(15)10-20-16-12-25-17(18(16)22)11-21-26(23,24)14-7-2-1-3-8-14/h1-9,16-18,20-22H,10-12H2 |
| InChIKey | UICZNDNCXOKGRG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |