C15H22N2O5S — CID 162800033
N-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]benzenesulfonamide (PubChem CID 162800033) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]benzenesulfonamide.
| Compound Name | N-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162800033 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[4-hydroxy-5-(morpholin-4-ylmethyl)oxolan-3-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1COC(CN2CCOCC2)C1O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O5S/c18-15-13(16-23(19,20)12-4-2-1-3-5-12)11-22-14(15)10-17-6-8-21-9-7-17/h1-5,13-16,18H,6-11H2 |
| InChIKey | NNHAGDYDFBUCDE-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |