C23H22N2O4S2 — CID 126690427
N-(4-hydroxy-5-phenothiazin-10-yloxan-3-yl)benzenesulfonamide (PubChem CID 126690427) has the molecular formula C23H22N2O4S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-(4-hydroxy-5-phenothiazin-10-yloxan-3-yl)benzenesulfonamide.
| Compound Name | N-(4-hydroxy-5-phenothiazin-10-yloxan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 126690427 |
| Molecular Formula | C23H22N2O4S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-(4-hydroxy-5-phenothiazin-10-yloxan-3-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1COCC(N2c3ccccc3Sc3ccccc32)C1O)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O4S2/c26-23-17(24-31(27,28)16-8-2-1-3-9-16)14-29-15-20(23)25-18-10-4-6-12-21(18)30-22-13-7-5-11-19(22)25/h1-13,17,20,23-24,26H,14-15H2 |
| InChIKey | RFUGVBYBUAOKPR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |