C17H24N4O4S — CID 162799564
3-cyano-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzenesulfonamide (PubChem CID 162799564) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-cyano-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 162799564 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-cyano-N-[4-hydroxy-5-[(4-methylpiperazin-1-yl)methyl]oxolan-3-yl]benzenesulfonamide |
| SMILES | CN1CCN(CC2OCC(NS(=O)(=O)c3cccc(C#N)c3)C2O)CC1 |
| InChI | InChI=1S/C17H24N4O4S/c1-20-5-7-21(8-6-20)11-16-17(22)15(12-25-16)19-26(23,24)14-4-2-3-13(9-14)10-18/h2-4,9,15-17,19,22H,5-8,11-12H2,1H3 |
| InChIKey | NRRVRYYNHBDNTA-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |