C18H26N2O4 — CID 75536563
N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]cyclopentanecarboxamide (PubChem CID 75536563) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]cyclopentanecarboxamide.
| Compound Name | N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 75536563 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]cyclopentanecarboxamide |
| SMILES | O=C(NC[C@H]1OC[C@@H](NCc2ccccc2O)[C@@H]1O)C1CCCC1 |
| InChI | InChI=1S/C18H26N2O4/c21-15-8-4-3-7-13(15)9-19-14-11-24-16(17(14)22)10-20-18(23)12-5-1-2-6-12/h3-4,7-8,12,14,16-17,19,21-22H,1-2,5-6,9-11H2,(H,20,23)/t14-,16-,17+/m1/s1 |
| InChIKey | VUNPBNNYCOFATJ-OIISXLGYSA-N |
| XLogP | 0.92 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|