C21H28N4O4S — CID 75543296
5-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(4-ethylphenyl)pyrazolidine-3-carboxamide (PubChem CID 75543296) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(4-ethylphenyl)pyrazolidine-3-carboxamide.
| Compound Name | 5-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(4-ethylphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75543296 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 5-[3-(dimethylsulfamoyl)-4-methoxyphenyl]-N-(4-ethylphenyl)pyrazolidine-3-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2CC(c3ccc(OC)c(S(=O)(=O)N(C)C)c3)NN2)cc1 |
| InChI | InChI=1S/C21H28N4O4S/c1-5-14-6-9-16(10-7-14)22-21(26)18-13-17(23-24-18)15-8-11-19(29-4)20(12-15)30(27,28)25(2)3/h6-12,17-18,23-24H,5,13H2,1-4H3,(H,22,26) |
| InChIKey | QZYGXUSVJGYEEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |