C17H17BrN4OS2 — CID 75546846
12-[(3-bromophenyl)methylsulfanyl]-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one (PubChem CID 75546846) has the molecular formula C17H17BrN4OS2 and a molecular weight of 437.39 g/mol. Its IUPAC name is 12-[(3-bromophenyl)methylsulfanyl]-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one.
| Compound Name | 12-[(3-bromophenyl)methylsulfanyl]-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one |
|---|---|
| PubChem CID | 75546846 |
| Molecular Formula | C17H17BrN4OS2 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 12-[(3-bromophenyl)methylsulfanyl]-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one |
| SMILES | CCCN1C(=O)c2sccc2N2C(SCc3cccc(Br)c3)=NNC12 |
| InChI | InChI=1S/C17H17BrN4OS2/c1-2-7-21-15(23)14-13(6-8-24-14)22-16(21)19-20-17(22)25-10-11-4-3-5-12(18)9-11/h3-6,8-9,16,19H,2,7,10H2,1H3 |
| InChIKey | IVFHOCKPQJSUAH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |