C19H22N4O2S2 — CID 75546887
8-butyl-12-[(3-methoxyphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one (PubChem CID 75546887) has the molecular formula C19H22N4O2S2 and a molecular weight of 402.55 g/mol. Its IUPAC name is 8-butyl-12-[(3-methoxyphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one.
| Compound Name | 8-butyl-12-[(3-methoxyphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one |
|---|---|
| PubChem CID | 75546887 |
| Molecular Formula | C19H22N4O2S2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 8-butyl-12-[(3-methoxyphenyl)methylsulfanyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-7-one |
| SMILES | CCCCN1C(=O)c2sccc2N2C(SCc3cccc(OC)c3)=NNC12 |
| InChI | InChI=1S/C19H22N4O2S2/c1-3-4-9-22-17(24)16-15(8-10-26-16)23-18(22)20-21-19(23)27-12-13-6-5-7-14(11-13)25-2/h5-8,10-11,18,20H,3-4,9,12H2,1-2H3 |
| InChIKey | DEXWPINBKZJSMX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |