C23H29N5O4S — CID 75118292
3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide (PubChem CID 75118292) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide.
| Compound Name | 3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 75118292 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[(2,5-dimethoxyphenyl)methyl]propanamide |
| SMILES | CCCCN1C(=O)c2sccc2N2C(CCC(=O)NCc3cc(OC)ccc3OC)=NNC12 |
| InChI | InChI=1S/C23H29N5O4S/c1-4-5-11-27-22(30)21-17(10-12-33-21)28-19(25-26-23(27)28)8-9-20(29)24-14-15-13-16(31-2)6-7-18(15)32-3/h6-7,10,12-13,23,26H,4-5,8-9,11,14H2,1-3H3,(H,24,29) |
| InChIKey | XLWFZQCIGJLECP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |