C21H26N6O4S2 — CID 75544655
3-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 75544655) has the molecular formula C21H26N6O4S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 75544655 |
| Molecular Formula | C21H26N6O4S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 3-(7-oxo-8-propyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CCCN1C(=O)c2sccc2N2C(CCC(=O)NCCc3ccc(S(N)(=O)=O)cc3)=NNC12 |
| InChI | InChI=1S/C21H26N6O4S2/c1-2-12-26-20(29)19-16(10-13-32-19)27-17(24-25-21(26)27)7-8-18(28)23-11-9-14-3-5-15(6-4-14)33(22,30)31/h3-6,10,13,21,25H,2,7-9,11-12H2,1H3,(H,23,28)(H2,22,30,31) |
| InChIKey | MJIDCEKARXIOGJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |