C22H27N5O2S2 — CID 75549313
2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 75549313) has the molecular formula C22H27N5O2S2 and a molecular weight of 457.63 g/mol. Its IUPAC name is 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 75549313 |
| Molecular Formula | C22H27N5O2S2 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-[(8-butyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,11-trien-12-yl)sulfanyl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCCCN1C(=O)c2sccc2N2C(SCC(=O)Nc3c(C)cc(C)cc3C)=NNC12 |
| InChI | InChI=1S/C22H27N5O2S2/c1-5-6-8-26-20(29)19-16(7-9-30-19)27-21(26)24-25-22(27)31-12-17(28)23-18-14(3)10-13(2)11-15(18)4/h7,9-11,21,24H,5-6,8,12H2,1-4H3,(H,23,28) |
| InChIKey | AZEXIPWJGJCIKW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |