C16H23FN6O — CID 75584274
[5-(2-fluoroanilino)triazolidin-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 75584274) has the molecular formula C16H23FN6O and a molecular weight of 334.40 g/mol. Its IUPAC name is [5-(2-fluoroanilino)triazolidin-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone.
| Compound Name | [5-(2-fluoroanilino)triazolidin-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 75584274 |
| Molecular Formula | C16H23FN6O |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [5-(2-fluoroanilino)triazolidin-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)C2NNNC2Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C16H23FN6O/c1-2-7-22-8-10-23(11-9-22)16(24)14-15(20-21-19-14)18-13-6-4-3-5-12(13)17/h2-6,14-15,18-21H,1,7-11H2 |
| InChIKey | HYNHCXYUPAEPOJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|