C17H27FN6O — CID 75584275
(4-butylpiperazin-1-yl)-[5-(2-fluoroanilino)triazolidin-4-yl]methanone (PubChem CID 75584275) has the molecular formula C17H27FN6O and a molecular weight of 350.44 g/mol. Its IUPAC name is (4-butylpiperazin-1-yl)-[5-(2-fluoroanilino)triazolidin-4-yl]methanone.
| Compound Name | (4-butylpiperazin-1-yl)-[5-(2-fluoroanilino)triazolidin-4-yl]methanone |
|---|---|
| PubChem CID | 75584275 |
| Molecular Formula | C17H27FN6O |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (4-butylpiperazin-1-yl)-[5-(2-fluoroanilino)triazolidin-4-yl]methanone |
| SMILES | CCCCN1CCN(C(=O)C2NNNC2Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H27FN6O/c1-2-3-8-23-9-11-24(12-10-23)17(25)15-16(21-22-20-15)19-14-7-5-4-6-13(14)18/h4-7,15-16,19-22H,2-3,8-12H2,1H3 |
| InChIKey | MSEGNYLUJHUDHU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |