C19H22ClFN6O — CID 75584224
[5-(4-chloroanilino)triazolidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 75584224) has the molecular formula C19H22ClFN6O and a molecular weight of 404.88 g/mol. Its IUPAC name is [5-(4-chloroanilino)triazolidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(4-chloroanilino)triazolidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 75584224 |
| Molecular Formula | C19H22ClFN6O |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [5-(4-chloroanilino)triazolidin-4-yl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1NNNC1Nc1ccc(Cl)cc1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H22ClFN6O/c20-13-5-7-14(8-6-13)22-18-17(23-25-24-18)19(28)27-11-9-26(10-12-27)16-4-2-1-3-15(16)21/h1-8,17-18,22-25H,9-12H2 |
| InChIKey | FLLZCHUNQYDUNN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |