C29H30O13 — CID 75600222
[4,5-diacetyloxy-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-2-propyloxan-3-yl] acetate (PubChem CID 75600222) has the molecular formula C29H30O13 and a molecular weight of 586.55 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-2-propyloxan-3-yl] acetate.
| Compound Name | [4,5-diacetyloxy-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-2-propyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 75600222 |
| Molecular Formula | C29H30O13 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [4,5-diacetyloxy-6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-2-propyloxan-3-yl] acetate |
| SMILES | CCCC1OC(Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C29H30O13/c1-5-6-20-25(37-13(2)30)27(38-14(3)31)28(39-15(4)32)29(41-20)42-26-23(36)22-19(35)11-18(34)12-21(22)40-24(26)16-7-9-17(33)10-8-16/h7-12,20,25,27-29,33-35H,5-6H2,1-4H3 |
| InChIKey | HDCQFGSWWKAJHS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 188.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|