C17H12Cl2N2O4 — CID 7560069
[(2S)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate (PubChem CID 7560069) has the molecular formula C17H12Cl2N2O4 and a molecular weight of 379.20 g/mol. Its IUPAC name is [(2S)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7560069 |
| Molecular Formula | C17H12Cl2N2O4 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | [(2S)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] (E)-2-cyano-3-(furan-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C(C#N)=C/c1ccco1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl2N2O4/c1-10(16(22)21-14-6-2-5-13(18)15(14)19)25-17(23)11(9-20)8-12-4-3-7-24-12/h2-8,10H,1H3,(H,21,22)/b11-8+/t10-/m0/s1 |
| InChIKey | NFCVZEXLRSTRJN-NGPGYTDTSA-N |
| XLogP | 4.06 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|