C12H14N5O2+ — CID 75609030
2-(3,8-dimethyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetonitrile (PubChem CID 75609030) has the molecular formula C12H14N5O2+ and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-(3,8-dimethyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetonitrile.
| Compound Name | 2-(3,8-dimethyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetonitrile |
|---|---|
| PubChem CID | 75609030 |
| Molecular Formula | C12H14N5O2+ |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(3,8-dimethyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetonitrile |
| SMILES | C=CC[N+]1=C(C)N=C2C1C(=O)N(CC#N)C(=O)N2C |
| InChI | InChI=1S/C12H14N5O2/c1-4-6-16-8(2)14-10-9(16)11(18)17(7-5-13)12(19)15(10)3/h4,9H,1,6-7H2,2-3H3/q+1 |
| InChIKey | WFWFAOQVARNUIP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 79.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|