C23H31N3O2S — CID 7562763
(2R)-2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 7562763) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is (2R)-2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | (2R)-2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 7562763 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2R)-2-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | C[C@@H](Sc1nnc(-c2ccc(C(C)(C)C)cc2)o1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H31N3O2S/c1-16(20(27)24-15-14-17-8-6-5-7-9-17)29-22-26-25-21(28-22)18-10-12-19(13-11-18)23(2,3)4/h8,10-13,16H,5-7,9,14-15H2,1-4H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | NILYZQHASSLOCQ-MRXNPFEDSA-N |
| XLogP | 5.52 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|