C22H26N4O2S — CID 92901955
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(1-methylindol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide (PubChem CID 92901955) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(1-methylindol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(1-methylindol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 92901955 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-(1-methylindol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C[C@@H](Sc1nnc(-c2cc3ccccc3n2C)o1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H26N4O2S/c1-15(20(27)23-13-12-16-8-4-3-5-9-16)29-22-25-24-21(28-22)19-14-17-10-6-7-11-18(17)26(19)2/h6-8,10-11,14-15H,3-5,9,12-13H2,1-2H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | CBDKNHFPZRAKDV-OAHLLOKOSA-N |
| XLogP | 4.72 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|