C23H32N4O4S2 — CID 2084742
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-[3-(diethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide (PubChem CID 2084742) has the molecular formula C23H32N4O4S2 and a molecular weight of 492.67 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-[3-(diethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-[3-(diethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 2084742 |
| Molecular Formula | C23H32N4O4S2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-[[5-[3-(diethylsulfamoyl)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(S[C@@H](C)C(=O)NCCC3=CCCCC3)o2)c1 |
| InChI | InChI=1S/C23H32N4O4S2/c1-4-27(5-2)33(29,30)20-13-9-12-19(16-20)22-25-26-23(31-22)32-17(3)21(28)24-15-14-18-10-7-6-8-11-18/h9-10,12-13,16-17H,4-8,11,14-15H2,1-3H3,(H,24,28)/t17-/m0/s1 |
| InChIKey | WCWGYAQXDCTPMH-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|