C19H18N2 — CID 757371
2,3-diphenyl-1,4-diazaspiro[4.4]nona-1,3-diene (PubChem CID 757371) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2,3-diphenyl-1,4-diazaspiro[4.4]nona-1,3-diene.
| Compound Name | 2,3-diphenyl-1,4-diazaspiro[4.4]nona-1,3-diene |
|---|---|
| PubChem CID | 757371 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2,3-diphenyl-1,4-diazaspiro[4.4]nona-1,3-diene |
| SMILES | c1ccc(C2=NC3(CCCC3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N2/c1-3-9-15(10-4-1)17-18(16-11-5-2-6-12-16)21-19(20-17)13-7-8-14-19/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | WOLDICVUVLWJKD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |