C29H25NO2 — CID 146162486
(4-benzoyl-2-phenyl-1-azaspiro[4.5]deca-1,3-dien-3-yl)-phenylmethanone (PubChem CID 146162486) has the molecular formula C29H25NO2 and a molecular weight of 419.52 g/mol. Its IUPAC name is (4-benzoyl-2-phenyl-1-azaspiro[4.5]deca-1,3-dien-3-yl)-phenylmethanone.
| Compound Name | (4-benzoyl-2-phenyl-1-azaspiro[4.5]deca-1,3-dien-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 146162486 |
| Molecular Formula | C29H25NO2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (4-benzoyl-2-phenyl-1-azaspiro[4.5]deca-1,3-dien-3-yl)-phenylmethanone |
| SMILES | O=C(C1=C(C(=O)c2ccccc2)C2(CCCCC2)N=C1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO2/c31-27(22-15-7-2-8-16-22)24-25(28(32)23-17-9-3-10-18-23)29(19-11-4-12-20-29)30-26(24)21-13-5-1-6-14-21/h1-3,5-10,13-18H,4,11-12,19-20H2 |
| InChIKey | JMGHXKMUCGPYFP-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |