C19H17N3O4S — CID 7573846
5-[(6-methylnaphthalen-2-yl)sulfonylamino]benzene-1,3-dicarboxamide (PubChem CID 7573846) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is 5-[(6-methylnaphthalen-2-yl)sulfonylamino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[(6-methylnaphthalen-2-yl)sulfonylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 7573846 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 5-[(6-methylnaphthalen-2-yl)sulfonylamino]benzene-1,3-dicarboxamide |
| SMILES | Cc1ccc2cc(S(=O)(=O)Nc3cc(C(N)=O)cc(C(N)=O)c3)ccc2c1 |
| InChI | InChI=1S/C19H17N3O4S/c1-11-2-3-13-10-17(5-4-12(13)6-11)27(25,26)22-16-8-14(18(20)23)7-15(9-16)19(21)24/h2-10,22H,1H3,(H2,20,23)(H2,21,24) |
| InChIKey | BTRNIOKLYRXSNM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |