C20H22N4O3 — CID 75768589
2,6-dimethyl-2-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 75768589) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2,6-dimethyl-2-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2,6-dimethyl-2-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75768589 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2,6-dimethyl-2-(4-pyridin-2-ylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C(=O)N1CCN(c3ccccn3)CC1)O2 |
| InChI | InChI=1S/C20H22N4O3/c1-14-6-7-16-15(13-14)22-18(25)20(2,27-16)19(26)24-11-9-23(10-12-24)17-5-3-4-8-21-17/h3-8,13H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | SYGBNBZGSWACJN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|