C19H19FN4O3 — CID 95102393
(2R)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-methyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 95102393) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is (2R)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-methyl-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | (2R)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-methyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 95102393 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2R)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]-2-methyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | C[C@@]1(C(=O)N2CCN(c3ccccc3F)CC2)Oc2cccnc2NC1=O |
| InChI | InChI=1S/C19H19FN4O3/c1-19(17(25)22-16-15(27-19)7-4-8-21-16)18(26)24-11-9-23(10-12-24)14-6-3-2-5-13(14)20/h2-8H,9-12H2,1H3,(H,21,22,25)/t19-/m1/s1 |
| InChIKey | DFPLQINZDJKMBA-LJQANCHMSA-N |
| XLogP | 1.66 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|