C21H21ClFN3O3 — CID 75796387
6-chloro-2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 75796387) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is 6-chloro-2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-chloro-2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75796387 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 6-chloro-2-[4-[(2-fluorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C(=O)N2CCN(Cc3ccccc3F)CC2)Oc2ccc(Cl)cc2NC1=O |
| InChI | InChI=1S/C21H21ClFN3O3/c1-21(19(27)24-17-12-15(22)6-7-18(17)29-21)20(28)26-10-8-25(9-11-26)13-14-4-2-3-5-16(14)23/h2-7,12H,8-11,13H2,1H3,(H,24,27) |
| InChIKey | HAASTMIZKSJMIB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|