C19H19FN2O3 — CID 75768506
N-[(2-fluorophenyl)methyl]-N,2,6-trimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75768506) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N,2,6-trimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N,2,6-trimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75768506 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N,2,6-trimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C(=O)N(C)Cc1ccccc1F)O2 |
| InChI | InChI=1S/C19H19FN2O3/c1-12-8-9-16-15(10-12)21-17(23)19(2,25-16)18(24)22(3)11-13-6-4-5-7-14(13)20/h4-10H,11H2,1-3H3,(H,21,23) |
| InChIKey | BYHPXVGXUDAZNQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|