C20H20N4O3 — CID 75796156
N-(1-ethylbenzimidazol-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75796156) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-(1-ethylbenzimidazol-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(1-ethylbenzimidazol-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75796156 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(1-ethylbenzimidazol-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | CCn1c(NC(=O)C2(C)Oc3ccc(C)cc3NC2=O)nc2ccccc21 |
| InChI | InChI=1S/C20H20N4O3/c1-4-24-15-8-6-5-7-13(15)22-19(24)23-18(26)20(3)17(25)21-14-11-12(2)9-10-16(14)27-20/h5-11H,4H2,1-3H3,(H,21,25)(H,22,23,26) |
| InChIKey | GHSCOVVNDZFTRV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|