C21H22ClN3O2S — CID 75767759
2-[4-[(2-chlorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 75767759) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[4-[(2-chlorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 75767759 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methyl]piperazine-1-carbonyl]-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1(C(=O)N2CCN(Cc3ccccc3Cl)CC2)Sc2ccccc2NC1=O |
| InChI | InChI=1S/C21H22ClN3O2S/c1-21(19(26)23-17-8-4-5-9-18(17)28-21)20(27)25-12-10-24(11-13-25)14-15-6-2-3-7-16(15)22/h2-9H,10-14H2,1H3,(H,23,26) |
| InChIKey | NCHPSWXCPJQEET-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|