C20H23N5O3 — CID 75768443
4-ethyl-2-methyl-2-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-1,4-benzoxazin-3-one (PubChem CID 75768443) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-ethyl-2-methyl-2-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-ethyl-2-methyl-2-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75768443 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 4-ethyl-2-methyl-2-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-1,4-benzoxazin-3-one |
| SMILES | CCN1C(=O)C(C)(C(=O)N2CCN(c3ncccn3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C20H23N5O3/c1-3-25-15-7-4-5-8-16(15)28-20(2,18(25)27)17(26)23-11-13-24(14-12-23)19-21-9-6-10-22-19/h4-10H,3,11-14H2,1-2H3 |
| InChIKey | KWCYVGYWOSPMHZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|