C25H24N2O5S — CID 75769548
ethyl 4-phenyl-2-[(2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 75769548) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is ethyl 4-phenyl-2-[(2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-phenyl-2-[(2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 75769548 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | ethyl 4-phenyl-2-[(2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C1(C)Oc2ccc(C)cc2N(C)C1=O |
| InChI | InChI=1S/C25H24N2O5S/c1-5-31-22(28)20-17(16-9-7-6-8-10-16)14-33-21(20)26-23(29)25(3)24(30)27(4)18-13-15(2)11-12-19(18)32-25/h6-14H,5H2,1-4H3,(H,26,29) |
| InChIKey | NYVNJHMAAWYIMP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|