C18H19N3O3 — CID 75769904
2,4,6-trimethyl-N-(3-methyl-2-pyridinyl)-3-oxo-1,4-benzoxazine-2-carboxamide (PubChem CID 75769904) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(3-methyl-2-pyridinyl)-3-oxo-1,4-benzoxazine-2-carboxamide.
| Compound Name | 2,4,6-trimethyl-N-(3-methyl-2-pyridinyl)-3-oxo-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75769904 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2,4,6-trimethyl-N-(3-methyl-2-pyridinyl)-3-oxo-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)Nc1ncccc1C)O2 |
| InChI | InChI=1S/C18H19N3O3/c1-11-7-8-14-13(10-11)21(4)17(23)18(3,24-14)16(22)20-15-12(2)6-5-9-19-15/h5-10H,1-4H3,(H,19,20,22) |
| InChIKey | MDZOBTBBNHUFPM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|