C17H22N2O3 — CID 75768668
2,4,6-trimethyl-2-(piperidine-1-carbonyl)-1,4-benzoxazin-3-one (PubChem CID 75768668) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2,4,6-trimethyl-2-(piperidine-1-carbonyl)-1,4-benzoxazin-3-one.
| Compound Name | 2,4,6-trimethyl-2-(piperidine-1-carbonyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75768668 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2,4,6-trimethyl-2-(piperidine-1-carbonyl)-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)N1CCCCC1)O2 |
| InChI | InChI=1S/C17H22N2O3/c1-12-7-8-14-13(11-12)18(3)15(20)17(2,22-14)16(21)19-9-5-4-6-10-19/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | CNBHCWFIKQACIG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|