C18H24N2O4 — CID 75768674
2-(2,6-dimethylmorpholine-4-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one (PubChem CID 75768674) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholine-4-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one.
| Compound Name | 2-(2,6-dimethylmorpholine-4-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 75768674 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-(2,6-dimethylmorpholine-4-carbonyl)-2,4,6-trimethyl-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc2c(c1)N(C)C(=O)C(C)(C(=O)N1CC(C)OC(C)C1)O2 |
| InChI | InChI=1S/C18H24N2O4/c1-11-6-7-15-14(8-11)19(5)16(21)18(4,24-15)17(22)20-9-12(2)23-13(3)10-20/h6-8,12-13H,9-10H2,1-5H3 |
| InChIKey | XZRMVIBTZZBEGA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|