C19H16N2O5 — CID 7578713
1,3-benzodioxol-5-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate (PubChem CID 7578713) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 7578713 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)Oc3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C19H16N2O5/c1-3-21-15-6-4-12(8-14(15)20-11(2)18(21)22)19(23)26-13-5-7-16-17(9-13)25-10-24-16/h4-9H,3,10H2,1-2H3 |
| InChIKey | VTNKKPYPSWBVCA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|