C19H17N3O3S — CID 75796079
N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 75796079) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75796079 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,6-dimethyl-3-oxo-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)(C(=O)Nc1sc3c(c1C#N)CCC3)O2 |
| InChI | InChI=1S/C19H17N3O3S/c1-10-6-7-14-13(8-10)21-17(23)19(2,25-14)18(24)22-16-12(9-20)11-4-3-5-15(11)26-16/h6-8H,3-5H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | OJLOTFGKGFAJMQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|