C23H27N3O4S — CID 75769555
N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide (PubChem CID 75769555) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 75769555 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N-[3-(ethylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2,4,6-trimethyl-3-oxo-1,4-benzoxazine-2-carboxamide |
| SMILES | CCNC(=O)c1c(NC(=O)C2(C)Oc3ccc(C)cc3N(C)C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C23H27N3O4S/c1-5-24-19(27)18-14-8-6-7-9-17(14)31-20(18)25-21(28)23(3)22(29)26(4)15-12-13(2)10-11-16(15)30-23/h10-12H,5-9H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | MJPMMUYNBFJDQS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|