C15H24N3O3S+ — CID 7585641
ethyl 6-methyl-2-oxo-4-(2-piperidin-1-ium-1-ylethylsulfanyl)-1H-pyrimidine-5-carboxylate (PubChem CID 7585641) has the molecular formula C15H24N3O3S+ and a molecular weight of 326.44 g/mol. Its IUPAC name is ethyl 6-methyl-2-oxo-4-(2-piperidin-1-ium-1-ylethylsulfanyl)-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-2-oxo-4-(2-piperidin-1-ium-1-ylethylsulfanyl)-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7585641 |
| Molecular Formula | C15H24N3O3S+ |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | ethyl 6-methyl-2-oxo-4-(2-piperidin-1-ium-1-ylethylsulfanyl)-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(SCC[NH+]2CCCCC2)nc(=O)[nH]c1C |
| InChI | InChI=1S/C15H23N3O3S/c1-3-21-14(19)12-11(2)16-15(20)17-13(12)22-10-9-18-7-5-4-6-8-18/h3-10H2,1-2H3,(H,16,17,20)/p+1 |
| InChIKey | IRHIBEJZQWOQLT-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |