C17H16N6O4 — CID 7585700
N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-6-methyl-2-(4-nitropyrazol-1-yl)pyrimidin-4-amine (PubChem CID 7585700) has the molecular formula C17H16N6O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-6-methyl-2-(4-nitropyrazol-1-yl)pyrimidin-4-amine.
| Compound Name | N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-6-methyl-2-(4-nitropyrazol-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 7585700 |
| Molecular Formula | C17H16N6O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-6-methyl-2-(4-nitropyrazol-1-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(NC[C@@H]2COc3ccccc3O2)nc(-n2cc([N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C17H16N6O4/c1-11-6-16(21-17(20-11)22-9-12(7-19-22)23(24)25)18-8-13-10-26-14-4-2-3-5-15(14)27-13/h2-7,9,13H,8,10H2,1H3,(H,18,20,21)/t13-/m1/s1 |
| InChIKey | JHDJHEPXUKEOBQ-CYBMUJFWSA-N |
| XLogP | 2.13 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|