C23H33N3O — CID 75865074
1-[[4-(diethylaminomethyl)phenyl]methyl]-3-(4-phenylbutan-2-yl)urea (PubChem CID 75865074) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-[[4-(diethylaminomethyl)phenyl]methyl]-3-(4-phenylbutan-2-yl)urea.
| Compound Name | 1-[[4-(diethylaminomethyl)phenyl]methyl]-3-(4-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 75865074 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-[[4-(diethylaminomethyl)phenyl]methyl]-3-(4-phenylbutan-2-yl)urea |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)NC(C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H33N3O/c1-4-26(5-2)18-22-15-13-21(14-16-22)17-24-23(27)25-19(3)11-12-20-9-7-6-8-10-20/h6-10,13-16,19H,4-5,11-12,17-18H2,1-3H3,(H2,24,25,27) |
| InChIKey | HKDGVOCAGDDGKL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |