C26H28N4O3S — CID 75911702
1-[[3-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 75911702) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-[[3-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[[3-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75911702 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-[[3-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoylamino]phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1nc(COc2ccccc2C=CC(=O)Nc2cccc(CN3CCCC3C(N)=O)c2)cs1 |
| InChI | InChI=1S/C26H28N4O3S/c1-18-28-22(17-34-18)16-33-24-10-3-2-7-20(24)11-12-25(31)29-21-8-4-6-19(14-21)15-30-13-5-9-23(30)26(27)32/h2-4,6-8,10-12,14,17,23H,5,9,13,15-16H2,1H3,(H2,27,32)(H,29,31) |
| InChIKey | OBTMGXUVJDPJJT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|