C20H29N3O6 — CID 7595556
2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N,N-bis(2-methoxyethyl)acetamide (PubChem CID 7595556) has the molecular formula C20H29N3O6 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N,N-bis(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N,N-bis(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7595556 |
| Molecular Formula | C20H29N3O6 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-[(4R)-4-ethyl-4-(4-methoxyphenyl)-2,5-dioxoimidazolidin-1-yl]-N,N-bis(2-methoxyethyl)acetamide |
| SMILES | CC[C@]1(c2ccc(OC)cc2)NC(=O)N(CC(=O)N(CCOC)CCOC)C1=O |
| InChI | InChI=1S/C20H29N3O6/c1-5-20(15-6-8-16(29-4)9-7-15)18(25)23(19(26)21-20)14-17(24)22(10-12-27-2)11-13-28-3/h6-9H,5,10-14H2,1-4H3,(H,21,26)/t20-/m1/s1 |
| InChIKey | YIYJWLQTSWSOJX-HXUWFJFHSA-N |
| XLogP | 0.97 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|