C41H74NO8P — CID 75957343
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-6,9,12-trienoyloxypropyl] octadec-9-enoate (PubChem CID 75957343) has the molecular formula C41H74NO8P and a molecular weight of 740.02 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-6,9,12-trienoyloxypropyl] octadec-9-enoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-6,9,12-trienoyloxypropyl] octadec-9-enoate |
|---|---|
| PubChem CID | 75957343 |
| Molecular Formula | C41H74NO8P |
| Molecular Weight | 740.02 g/mol |
| Exact Mass | 739.52 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-6,9,12-trienoyloxypropyl] octadec-9-enoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H74NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42)50-41(44)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h12,14,17-20,24,26,39H,3-11,13,15-16,21-23,25,27-38,42H2,1-2H3,(H,45,46) |
| InChIKey | NUDNBLVZKRNECC-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.02 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|