C11H18O2 — CID 75972503
3-(1-hydroxybutyl)-2,4-dimethylcyclopent-2-en-1-one (PubChem CID 75972503) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-(1-hydroxybutyl)-2,4-dimethylcyclopent-2-en-1-one.
| Compound Name | 3-(1-hydroxybutyl)-2,4-dimethylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 75972503 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-(1-hydroxybutyl)-2,4-dimethylcyclopent-2-en-1-one |
| SMILES | CCCC(O)C1=C(C)C(=O)CC1C |
| InChI | InChI=1S/C11H18O2/c1-4-5-9(12)11-7(2)6-10(13)8(11)3/h7,9,12H,4-6H2,1-3H3 |
| InChIKey | NMGKVGASSWZGPX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |